C27H40N2O5Si — CID 11249074
tert-butyl N-[(2S)-1-[tert-butyl(diphenyl)silyl]oxy-6-nitrohexan-2-yl]carbamate (PubChem CID 11249074) has the molecular formula C27H40N2O5Si and a molecular weight of 500.71 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[tert-butyl(diphenyl)silyl]oxy-6-nitrohexan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[tert-butyl(diphenyl)silyl]oxy-6-nitrohexan-2-yl]carbamate |
|---|---|
| PubChem CID | 11249074 |
| Molecular Formula | C27H40N2O5Si |
| Molecular Weight | 500.71 g/mol |
| Exact Mass | 500.27 |
| IUPAC Name | tert-butyl N-[(2S)-1-[tert-butyl(diphenyl)silyl]oxy-6-nitrohexan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCCC[N+](=O)[O-])CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C27H40N2O5Si/c1-26(2,3)34-25(30)28-22(15-13-14-20-29(31)32)21-33-35(27(4,5)6,23-16-9-7-10-17-23)24-18-11-8-12-19-24/h7-12,16-19,22H,13-15,20-21H2,1-6H3,(H,28,30)/t22-/m0/s1 |
| InChIKey | RTKGMLGIEAPNKZ-QFIPXVFZSA-N |
| XLogP | 4.90 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.71 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|