C26H25BF6N2O5S2 — CID 11204434
(3aS)-1-(2-methylphenyl)-3,3-diphenyl-4,5,6,7-tetrahydro-3aH-pyrrolo[1,2-c][1,3,2]oxazaborol-7-ium;bis(trifluoromethylsulfonyl)azanide (PubChem CID 11204434) has the molecular formula C26H25BF6N2O5S2 and a molecular weight of 634.43 g/mol. Its IUPAC name is (3aS)-1-(2-methylphenyl)-3,3-diphenyl-4,5,6,7-tetrahydro-3aH-pyrrolo[1,2-c][1,3,2]oxazaborol-7-ium;bis(trifluoromethylsulfonyl)azanide.
| Compound Name | (3aS)-1-(2-methylphenyl)-3,3-diphenyl-4,5,6,7-tetrahydro-3aH-pyrrolo[1,2-c][1,3,2]oxazaborol-7-ium;bis(trifluoromethylsulfonyl)azanide |
|---|---|
| PubChem CID | 11204434 |
| Molecular Formula | C26H25BF6N2O5S2 |
| Molecular Weight | 634.43 g/mol |
| Exact Mass | 634.12 |
| IUPAC Name | (3aS)-1-(2-methylphenyl)-3,3-diphenyl-4,5,6,7-tetrahydro-3aH-pyrrolo[1,2-c][1,3,2]oxazaborol-7-ium;bis(trifluoromethylsulfonyl)azanide |
| SMILES | Cc1ccccc1B1OC(c2ccccc2)(c2ccccc2)[C@@H]2CCC[NH+]12.O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C24H24BNO.C2F6NO4S2/c1-19-11-8-9-16-22(19)25-26-18-10-17-23(26)24(27-25,20-12-4-2-5-13-20)21-14-6-3-7-15-21;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h2-9,11-16,23H,10,17-18H2,1H3;/q;-1/p+1/t23-;/m0./s1 |
| InChIKey | CJRMFCHFCOGOQP-BQAIUKQQSA-O |
| XLogP | 3.77 |
| TPSA | 96.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.43 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|