C13H14O3 — CID 11206733
(3aS,9R,9aS)-9-ethenyl-3,3a,4,5,8,9-hexahydrocyclopenta[h][2]benzofuran-1,7-dione (PubChem CID 11206733) has the molecular formula C13H14O3 and a molecular weight of 218.25 g/mol. Its IUPAC name is (3aS,9R,9aS)-9-ethenyl-3,3a,4,5,8,9-hexahydrocyclopenta[h][2]benzofuran-1,7-dione.
| Compound Name | (3aS,9R,9aS)-9-ethenyl-3,3a,4,5,8,9-hexahydrocyclopenta[h][2]benzofuran-1,7-dione |
|---|---|
| PubChem CID | 11206733 |
| Molecular Formula | C13H14O3 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | (3aS,9R,9aS)-9-ethenyl-3,3a,4,5,8,9-hexahydrocyclopenta[h][2]benzofuran-1,7-dione |
| SMILES | C=C[C@H]1CC(=O)C2=CCC[C@@H]3COC(=O)[C@]231 |
| InChI | InChI=1S/C13H14O3/c1-2-8-6-11(14)10-5-3-4-9-7-16-12(15)13(8,9)10/h2,5,8-9H,1,3-4,6-7H2/t8-,9+,13-/m0/s1 |
| InChIKey | GUZYKYBFYIEHQR-RWEMILLDSA-N |
| XLogP | 1.64 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|