C15H20O3 — CID 139095225
(3aS,9R,9aS)-9-ethyl-3,3-dimethyl-4,5,8,9-tetrahydro-3aH-indeno[1,7a-c]furan-1,7-dione (PubChem CID 139095225) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is (3aS,9R,9aS)-9-ethyl-3,3-dimethyl-4,5,8,9-tetrahydro-3aH-indeno[1,7a-c]furan-1,7-dione.
| Compound Name | (3aS,9R,9aS)-9-ethyl-3,3-dimethyl-4,5,8,9-tetrahydro-3aH-indeno[1,7a-c]furan-1,7-dione |
|---|---|
| PubChem CID | 139095225 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | (3aS,9R,9aS)-9-ethyl-3,3-dimethyl-4,5,8,9-tetrahydro-3aH-indeno[1,7a-c]furan-1,7-dione |
| SMILES | CC[C@@H]1CC(=O)C=C2CC[C@@H]3C(C)(C)OC(=O)[C@@]213 |
| InChI | InChI=1S/C15H20O3/c1-4-9-7-11(16)8-10-5-6-12-14(2,3)18-13(17)15(9,10)12/h8-9,12H,4-7H2,1-3H3/t9-,12-,15-/m1/s1 |
| InChIKey | DBXRERFFCSMDGG-DDHOLCJHSA-N |
| XLogP | 2.64 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |