C11H12O3 — CID 140813595
(1R,6R)-8-oxatricyclo[4.3.3.01,6]dodec-4-ene-7,11-dione (PubChem CID 140813595) has the molecular formula C11H12O3 and a molecular weight of 192.21 g/mol. Its IUPAC name is (1R,6R)-8-oxatricyclo[4.3.3.01,6]dodec-4-ene-7,11-dione.
| Compound Name | (1R,6R)-8-oxatricyclo[4.3.3.01,6]dodec-4-ene-7,11-dione |
|---|---|
| PubChem CID | 140813595 |
| Molecular Formula | C11H12O3 |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | (1R,6R)-8-oxatricyclo[4.3.3.01,6]dodec-4-ene-7,11-dione |
| SMILES | O=C1C[C@]23CCC=C[C@@]2(C1)C(=O)OC3 |
| InChI | InChI=1S/C11H12O3/c12-8-5-10-3-1-2-4-11(10,6-8)9(13)14-7-10/h2,4H,1,3,5-7H2/t10-,11+/m0/s1 |
| InChIKey | VLSPVLQFGFBRTI-WDEREUQCSA-N |
| XLogP | 1.23 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|