C8H11NO3Se — CID 11207380
ethyl (2S,5R)-7-oxo-4-selena-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 11207380) has the molecular formula C8H11NO3Se and a molecular weight of 248.14 g/mol. Its IUPAC name is ethyl (2S,5R)-7-oxo-4-selena-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | ethyl (2S,5R)-7-oxo-4-selena-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 11207380 |
| Molecular Formula | C8H11NO3Se |
| Molecular Weight | 248.14 g/mol |
| Exact Mass | 248.99 |
| IUPAC Name | ethyl (2S,5R)-7-oxo-4-selena-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | CCOC(=O)[C@H]1C[Se][C@@H]2CC(=O)N12 |
| InChI | InChI=1S/C8H11NO3Se/c1-2-12-8(11)5-4-13-7-3-6(10)9(5)7/h5,7H,2-4H2,1H3/t5-,7-/m1/s1 |
| InChIKey | VWDVSGCKKVFJCC-IYSWYEEDSA-N |
| XLogP | -0.39 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.14 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|