C13H22FNO3 — CID 11207668
tert-butyl (4S)-4-[(E)-3-fluoroprop-1-enyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 11207668) has the molecular formula C13H22FNO3 and a molecular weight of 259.32 g/mol. Its IUPAC name is tert-butyl (4S)-4-[(E)-3-fluoroprop-1-enyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4S)-4-[(E)-3-fluoroprop-1-enyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 11207668 |
| Molecular Formula | C13H22FNO3 |
| Molecular Weight | 259.32 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | tert-butyl (4S)-4-[(E)-3-fluoroprop-1-enyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@@H](/C=C/CF)COC1(C)C |
| InChI | InChI=1S/C13H22FNO3/c1-12(2,3)18-11(16)15-10(7-6-8-14)9-17-13(15,4)5/h6-7,10H,8-9H2,1-5H3/b7-6+/t10-/m0/s1 |
| InChIKey | HGDNYEBDQCKOGL-FGEFZZPRSA-N |
| XLogP | 2.88 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.32 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|