C17H12FNO — CID 11207811
2-[2-(3-fluorophenyl)ethynyl]-7,8-dihydro-6H-quinolin-5-one (PubChem CID 11207811) has the molecular formula C17H12FNO and a molecular weight of 265.29 g/mol. Its IUPAC name is 2-[2-(3-fluorophenyl)ethynyl]-7,8-dihydro-6H-quinolin-5-one.
| Compound Name | 2-[2-(3-fluorophenyl)ethynyl]-7,8-dihydro-6H-quinolin-5-one |
|---|---|
| PubChem CID | 11207811 |
| Molecular Formula | C17H12FNO |
| Molecular Weight | 265.29 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | 2-[2-(3-fluorophenyl)ethynyl]-7,8-dihydro-6H-quinolin-5-one |
| SMILES | O=C1CCCc2nc(C#Cc3cccc(F)c3)ccc21 |
| InChI | InChI=1S/C17H12FNO/c18-13-4-1-3-12(11-13)7-8-14-9-10-15-16(19-14)5-2-6-17(15)20/h1,3-4,9-11H,2,5-6H2 |
| InChIKey | XNJXPAACRCLMOS-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.29 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|