About 2-[2-(3-chlorophenyl)ethynyl]-6-methyl-7,8-dihydro-1,6-naphthyridin-5-one
2-[2-(3-chlorophenyl)ethynyl]-6-methyl-7,8-dihydro-1,6-naphthyridin-5-one (PubChem CID 54580598) has the molecular formula C17H13ClN2O
and a molecular weight of 296.76 g/mol. Its IUPAC name is 2-[2-(3-chlorophenyl)ethynyl]-6-methyl-7,8-dihydro-1,6-naphthyridin-5-one.
Molecular Properties
| Compound Name | 2-[2-(3-chlorophenyl)ethynyl]-6-methyl-7,8-dihydro-1,6-naphthyridin-5-one |
| PubChem CID | 54580598 |
| Molecular Formula | C17H13ClN2O |
| Molecular Weight | 296.76 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | 2-[2-(3-chlorophenyl)ethynyl]-6-methyl-7,8-dihydro-1,6-naphthyridin-5-one |
| SMILES | CN1CCc2nc(C#Cc3cccc(Cl)c3)ccc2C1=O |
| InChI | InChI=1S/C17H13ClN2O/c1-20-10-9-16-15(17(20)21)8-7-14(19-16)6-5-12-3-2-4-13(18)11-12/h2-4,7-8,11H,9-10H2,1H3 |
| InChIKey | UUAPOCHYLSFNHQ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.76 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(3-chlorophenyl)ethynyl]-6-methyl-7,8-dihydro-1,6-naphthyridin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(3-chlorophenyl)ethynyl]-6-methyl-7,8-dihydro-1,6-naphthyridin-5-one?
The IUPAC name of 2-[2-(3-chlorophenyl)ethynyl]-6-methyl-7,8-dihydro-1,6-naphthyridin-5-one (CID 54580598) is 2-[2-(3-chlorophenyl)ethynyl]-6-methyl-7,8-dihydro-1,6-naphthyridin-5-one.
What is the SMILES notation for 2-[2-(3-chlorophenyl)ethynyl]-6-methyl-7,8-dihydro-1,6-naphthyridin-5-one?
The canonical SMILES for 2-[2-(3-chlorophenyl)ethynyl]-6-methyl-7,8-dihydro-1,6-naphthyridin-5-one is CN1CCc2nc(C#Cc3cccc(Cl)c3)ccc2C1=O.
What is the InChIKey of 2-[2-(3-chlorophenyl)ethynyl]-6-methyl-7,8-dihydro-1,6-naphthyridin-5-one?
The InChIKey is UUAPOCHYLSFNHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13ClN2O/c1-20-10-9-16-15(17(20)21)8-7-14(19-16)6-5-12-3-2-4-13(18)11-12/h2-4,7-8,11H,9-10H2,1H3.
What are the key properties of 2-[2-(3-chlorophenyl)ethynyl]-6-methyl-7,8-dihydro-1,6-naphthyridin-5-one?
2-[2-(3-chlorophenyl)ethynyl]-6-methyl-7,8-dihydro-1,6-naphthyridin-5-one has a molecular weight of 296.76 g/mol, XLogP of 2.76, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(3-chlorophenyl)ethynyl]-6-methyl-7,8-dihydro-1,6-naphthyridin-5-one is sourced from PubChem (CID 54580598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).