C17H13ClN2O — CID 54580598
2-[2-(3-chlorophenyl)ethynyl]-6-methyl-7,8-dihydro-1,6-naphthyridin-5-one (PubChem CID 54580598) has the molecular formula C17H13ClN2O and a molecular weight of 296.76 g/mol. Its IUPAC name is 2-[2-(3-chlorophenyl)ethynyl]-6-methyl-7,8-dihydro-1,6-naphthyridin-5-one.
| Compound Name | 2-[2-(3-chlorophenyl)ethynyl]-6-methyl-7,8-dihydro-1,6-naphthyridin-5-one |
|---|---|
| PubChem CID | 54580598 |
| Molecular Formula | C17H13ClN2O |
| Molecular Weight | 296.76 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | 2-[2-(3-chlorophenyl)ethynyl]-6-methyl-7,8-dihydro-1,6-naphthyridin-5-one |
| SMILES | CN1CCc2nc(C#Cc3cccc(Cl)c3)ccc2C1=O |
| InChI | InChI=1S/C17H13ClN2O/c1-20-10-9-16-15(17(20)21)8-7-14(19-16)6-5-12-3-2-4-13(18)11-12/h2-4,7-8,11H,9-10H2,1H3 |
| InChIKey | UUAPOCHYLSFNHQ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.76 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|