C18H16N2O — CID 177305743
2-[2-(3-methylphenyl)ethynyl]-6,7,8,9-tetrahydropyrido[3,2-c]azepin-5-one (PubChem CID 177305743) has the molecular formula C18H16N2O and a molecular weight of 276.34 g/mol. Its IUPAC name is 2-[2-(3-methylphenyl)ethynyl]-6,7,8,9-tetrahydropyrido[3,2-c]azepin-5-one.
| Compound Name | 2-[2-(3-methylphenyl)ethynyl]-6,7,8,9-tetrahydropyrido[3,2-c]azepin-5-one |
|---|---|
| PubChem CID | 177305743 |
| Molecular Formula | C18H16N2O |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | 2-[2-(3-methylphenyl)ethynyl]-6,7,8,9-tetrahydropyrido[3,2-c]azepin-5-one |
| SMILES | Cc1cccc(C#Cc2ccc3c(n2)CCCNC3=O)c1 |
| InChI | InChI=1S/C18H16N2O/c1-13-4-2-5-14(12-13)7-8-15-9-10-16-17(20-15)6-3-11-19-18(16)21/h2,4-5,9-10,12H,3,6,11H2,1H3,(H,19,21) |
| InChIKey | ZRSJGNLNQSXTTC-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|