C18H15NO — CID 59746220
6-(2-phenylethynyl)-2,3,4,5-tetrahydro-2-benzazepin-1-one (PubChem CID 59746220) has the molecular formula C18H15NO and a molecular weight of 261.32 g/mol. Its IUPAC name is 6-(2-phenylethynyl)-2,3,4,5-tetrahydro-2-benzazepin-1-one.
| Compound Name | 6-(2-phenylethynyl)-2,3,4,5-tetrahydro-2-benzazepin-1-one |
|---|---|
| PubChem CID | 59746220 |
| Molecular Formula | C18H15NO |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | 6-(2-phenylethynyl)-2,3,4,5-tetrahydro-2-benzazepin-1-one |
| SMILES | O=C1NCCCc2c(C#Cc3ccccc3)cccc21 |
| InChI | InChI=1S/C18H15NO/c20-18-17-9-4-8-15(16(17)10-5-13-19-18)12-11-14-6-2-1-3-7-14/h1-4,6-9H,5,10,13H2,(H,19,20) |
| InChIKey | BGLQGKXYOVWXSM-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|