C17H16N2O — CID 170694222
5-[2-(5-methoxy-3-pyridinyl)ethynyl]-1,2,3,4-tetrahydroquinoline (PubChem CID 170694222) has the molecular formula C17H16N2O and a molecular weight of 264.33 g/mol. Its IUPAC name is 5-[2-(5-methoxy-3-pyridinyl)ethynyl]-1,2,3,4-tetrahydroquinoline.
| Compound Name | 5-[2-(5-methoxy-3-pyridinyl)ethynyl]-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 170694222 |
| Molecular Formula | C17H16N2O |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | 5-[2-(5-methoxy-3-pyridinyl)ethynyl]-1,2,3,4-tetrahydroquinoline |
| SMILES | COc1cncc(C#Cc2cccc3c2CCCN3)c1 |
| InChI | InChI=1S/C17H16N2O/c1-20-15-10-13(11-18-12-15)7-8-14-4-2-6-17-16(14)5-3-9-19-17/h2,4,6,10-12,19H,3,5,9H2,1H3 |
| InChIKey | MLYHXRUYKVMRQD-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|