C12H23BN2O4 — CID 11207943
[1-(3,3-diethoxypropyl)-3,5-dimethylpyrazol-4-yl]boronic acid (PubChem CID 11207943) has the molecular formula C12H23BN2O4 and a molecular weight of 270.14 g/mol. Its IUPAC name is [1-(3,3-diethoxypropyl)-3,5-dimethylpyrazol-4-yl]boronic acid.
| Compound Name | [1-(3,3-diethoxypropyl)-3,5-dimethylpyrazol-4-yl]boronic acid |
|---|---|
| PubChem CID | 11207943 |
| Molecular Formula | C12H23BN2O4 |
| Molecular Weight | 270.14 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | [1-(3,3-diethoxypropyl)-3,5-dimethylpyrazol-4-yl]boronic acid |
| SMILES | CCOC(CCn1nc(C)c(B(O)O)c1C)OCC |
| InChI | InChI=1S/C12H23BN2O4/c1-5-18-11(19-6-2)7-8-15-10(4)12(13(16)17)9(3)14-15/h11,16-17H,5-8H2,1-4H3 |
| InChIKey | FXHLGKFDZLPRSQ-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.14 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|