C20H18O3 — CID 11208975
2-(4-benzoyl-3,6-dihydro-2H-pyran-3-yl)-1-phenylethanone (PubChem CID 11208975) has the molecular formula C20H18O3 and a molecular weight of 306.36 g/mol. Its IUPAC name is 2-(4-benzoyl-3,6-dihydro-2H-pyran-3-yl)-1-phenylethanone.
| Compound Name | 2-(4-benzoyl-3,6-dihydro-2H-pyran-3-yl)-1-phenylethanone |
|---|---|
| PubChem CID | 11208975 |
| Molecular Formula | C20H18O3 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | 2-(4-benzoyl-3,6-dihydro-2H-pyran-3-yl)-1-phenylethanone |
| SMILES | O=C(CC1COCC=C1C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H18O3/c21-19(15-7-3-1-4-8-15)13-17-14-23-12-11-18(17)20(22)16-9-5-2-6-10-16/h1-11,17H,12-14H2 |
| InChIKey | JNEINOCEZJQZSD-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |