C15H19ClN2O3S — CID 11210070
ethyl (NZ)-N-[4-(chloromethyl)-3-[(4-methoxyphenyl)methyl]-1,3-thiazolidin-2-ylidene]carbamate (PubChem CID 11210070) has the molecular formula C15H19ClN2O3S and a molecular weight of 342.85 g/mol. Its IUPAC name is ethyl (NZ)-N-[4-(chloromethyl)-3-[(4-methoxyphenyl)methyl]-1,3-thiazolidin-2-ylidene]carbamate.
| Compound Name | ethyl (NZ)-N-[4-(chloromethyl)-3-[(4-methoxyphenyl)methyl]-1,3-thiazolidin-2-ylidene]carbamate |
|---|---|
| PubChem CID | 11210070 |
| Molecular Formula | C15H19ClN2O3S |
| Molecular Weight | 342.85 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | ethyl (NZ)-N-[4-(chloromethyl)-3-[(4-methoxyphenyl)methyl]-1,3-thiazolidin-2-ylidene]carbamate |
| SMILES | CCOC(=O)/N=C1\SCC(CCl)N1Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C15H19ClN2O3S/c1-3-21-15(19)17-14-18(12(8-16)10-22-14)9-11-4-6-13(20-2)7-5-11/h4-7,12H,3,8-10H2,1-2H3/b17-14- |
| InChIKey | PTEDXYWQTLZJLM-VKAVYKQESA-N |
| XLogP | 3.36 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.85 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|