C21H24N2O3S — CID 18284741
[4-ethyl-2-(4-methoxyphenyl)imino-1,3-thiazolidin-3-yl]-[4-(methoxymethyl)phenyl]methanone (PubChem CID 18284741) has the molecular formula C21H24N2O3S and a molecular weight of 384.50 g/mol. Its IUPAC name is [4-ethyl-2-(4-methoxyphenyl)imino-1,3-thiazolidin-3-yl]-[4-(methoxymethyl)phenyl]methanone.
| Compound Name | [4-ethyl-2-(4-methoxyphenyl)imino-1,3-thiazolidin-3-yl]-[4-(methoxymethyl)phenyl]methanone |
|---|---|
| PubChem CID | 18284741 |
| Molecular Formula | C21H24N2O3S |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | [4-ethyl-2-(4-methoxyphenyl)imino-1,3-thiazolidin-3-yl]-[4-(methoxymethyl)phenyl]methanone |
| SMILES | CCC1CS/C(=N\c2ccc(OC)cc2)N1C(=O)c1ccc(COC)cc1 |
| InChI | InChI=1S/C21H24N2O3S/c1-4-18-14-27-21(22-17-9-11-19(26-3)12-10-17)23(18)20(24)16-7-5-15(6-8-16)13-25-2/h5-12,18H,4,13-14H2,1-3H3/b22-21- |
| InChIKey | OAWVRLFIYBEEJP-DQRAZIAOSA-N |
| XLogP | 4.50 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|