C20H29N3O4S2 — CID 18224881
[4-ethyl-2-(4-methoxyphenyl)imino-1,3-thiazolidin-3-yl]-(1-ethylsulfonylpiperidin-4-yl)methanone (PubChem CID 18224881) has the molecular formula C20H29N3O4S2 and a molecular weight of 439.60 g/mol. Its IUPAC name is [4-ethyl-2-(4-methoxyphenyl)imino-1,3-thiazolidin-3-yl]-(1-ethylsulfonylpiperidin-4-yl)methanone.
| Compound Name | [4-ethyl-2-(4-methoxyphenyl)imino-1,3-thiazolidin-3-yl]-(1-ethylsulfonylpiperidin-4-yl)methanone |
|---|---|
| PubChem CID | 18224881 |
| Molecular Formula | C20H29N3O4S2 |
| Molecular Weight | 439.60 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | [4-ethyl-2-(4-methoxyphenyl)imino-1,3-thiazolidin-3-yl]-(1-ethylsulfonylpiperidin-4-yl)methanone |
| SMILES | CCC1CS/C(=N\c2ccc(OC)cc2)N1C(=O)C1CCN(S(=O)(=O)CC)CC1 |
| InChI | InChI=1S/C20H29N3O4S2/c1-4-17-14-28-20(21-16-6-8-18(27-3)9-7-16)23(17)19(24)15-10-12-22(13-11-15)29(25,26)5-2/h6-9,15,17H,4-5,10-14H2,1-3H3/b21-20- |
| InChIKey | ITWRHEGIWGZWAJ-MRCUWXFGSA-N |
| XLogP | 3.10 |
| TPSA | 79.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.60 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|