C26H22N2O5S2 — CID 2122426
3-[(4S)-4-ethyl-2-(4-methoxyphenyl)imino-1,3-thiazolidine-3-carbonyl]-10,10-dioxothioxanthen-9-one (PubChem CID 2122426) has the molecular formula C26H22N2O5S2 and a molecular weight of 506.61 g/mol. Its IUPAC name is 3-[(4S)-4-ethyl-2-(4-methoxyphenyl)imino-1,3-thiazolidine-3-carbonyl]-10,10-dioxothioxanthen-9-one.
| Compound Name | 3-[(4S)-4-ethyl-2-(4-methoxyphenyl)imino-1,3-thiazolidine-3-carbonyl]-10,10-dioxothioxanthen-9-one |
|---|---|
| PubChem CID | 2122426 |
| Molecular Formula | C26H22N2O5S2 |
| Molecular Weight | 506.61 g/mol |
| Exact Mass | 506.10 |
| IUPAC Name | 3-[(4S)-4-ethyl-2-(4-methoxyphenyl)imino-1,3-thiazolidine-3-carbonyl]-10,10-dioxothioxanthen-9-one |
| SMILES | CC[C@H]1CS/C(=N\c2ccc(OC)cc2)N1C(=O)c1ccc2c(c1)S(=O)(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C26H22N2O5S2/c1-3-18-15-34-26(27-17-9-11-19(33-2)12-10-17)28(18)25(30)16-8-13-21-23(14-16)35(31,32)22-7-5-4-6-20(22)24(21)29/h4-14,18H,3,15H2,1-2H3/b27-26-/t18-/m0/s1 |
| InChIKey | JQBSRGTYVWOCQB-GNYBCZIXSA-N |
| XLogP | 4.73 |
| TPSA | 93.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.61 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|