C20H22N2O3S — CID 8781007
[(4S)-4-ethyl-2-(4-methoxyphenyl)imino-1,3-thiazolidin-3-yl]-(3-methoxyphenyl)methanone (PubChem CID 8781007) has the molecular formula C20H22N2O3S and a molecular weight of 370.47 g/mol. Its IUPAC name is [(4S)-4-ethyl-2-(4-methoxyphenyl)imino-1,3-thiazolidin-3-yl]-(3-methoxyphenyl)methanone.
| Compound Name | [(4S)-4-ethyl-2-(4-methoxyphenyl)imino-1,3-thiazolidin-3-yl]-(3-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 8781007 |
| Molecular Formula | C20H22N2O3S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | [(4S)-4-ethyl-2-(4-methoxyphenyl)imino-1,3-thiazolidin-3-yl]-(3-methoxyphenyl)methanone |
| SMILES | CC[C@H]1CS/C(=N\c2ccc(OC)cc2)N1C(=O)c1cccc(OC)c1 |
| InChI | InChI=1S/C20H22N2O3S/c1-4-16-13-26-20(21-15-8-10-17(24-2)11-9-15)22(16)19(23)14-6-5-7-18(12-14)25-3/h5-12,16H,4,13H2,1-3H3/b21-20-/t16-/m0/s1 |
| InChIKey | JHQDDHAECVORAZ-JHBCHSCWSA-N |
| XLogP | 4.36 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|