C19H20N2OS — CID 7915910
[(4S)-4-ethyl-2-(3-methylphenyl)imino-1,3-thiazolidin-3-yl]-phenylmethanone (PubChem CID 7915910) has the molecular formula C19H20N2OS and a molecular weight of 324.45 g/mol. Its IUPAC name is [(4S)-4-ethyl-2-(3-methylphenyl)imino-1,3-thiazolidin-3-yl]-phenylmethanone.
| Compound Name | [(4S)-4-ethyl-2-(3-methylphenyl)imino-1,3-thiazolidin-3-yl]-phenylmethanone |
|---|---|
| PubChem CID | 7915910 |
| Molecular Formula | C19H20N2OS |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | [(4S)-4-ethyl-2-(3-methylphenyl)imino-1,3-thiazolidin-3-yl]-phenylmethanone |
| SMILES | CC[C@H]1CS/C(=N\c2cccc(C)c2)N1C(=O)c1ccccc1 |
| InChI | InChI=1S/C19H20N2OS/c1-3-17-13-23-19(20-16-11-7-8-14(2)12-16)21(17)18(22)15-9-5-4-6-10-15/h4-12,17H,3,13H2,1-2H3/b20-19-/t17-/m0/s1 |
| InChIKey | MPJUPMSKEBDQOB-SKQREZPOSA-N |
| XLogP | 4.65 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|