C17H15Cl2N3OS — CID 55335389
[2-(3,4-dichlorophenyl)imino-4-ethyl-1,3-thiazolidin-3-yl]-pyridin-2-ylmethanone (PubChem CID 55335389) has the molecular formula C17H15Cl2N3OS and a molecular weight of 380.30 g/mol. Its IUPAC name is [2-(3,4-dichlorophenyl)imino-4-ethyl-1,3-thiazolidin-3-yl]-pyridin-2-ylmethanone.
| Compound Name | [2-(3,4-dichlorophenyl)imino-4-ethyl-1,3-thiazolidin-3-yl]-pyridin-2-ylmethanone |
|---|---|
| PubChem CID | 55335389 |
| Molecular Formula | C17H15Cl2N3OS |
| Molecular Weight | 380.30 g/mol |
| Exact Mass | 379.03 |
| IUPAC Name | [2-(3,4-dichlorophenyl)imino-4-ethyl-1,3-thiazolidin-3-yl]-pyridin-2-ylmethanone |
| SMILES | CCC1CS/C(=N\c2ccc(Cl)c(Cl)c2)N1C(=O)c1ccccn1 |
| InChI | InChI=1S/C17H15Cl2N3OS/c1-2-12-10-24-17(21-11-6-7-13(18)14(19)9-11)22(12)16(23)15-5-3-4-8-20-15/h3-9,12H,2,10H2,1H3/b21-17- |
| InChIKey | SCNHZOPVYUHNIH-FXBPSFAMSA-N |
| XLogP | 5.04 |
| TPSA | 45.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.30 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|