C19H14N2O5 — CID 11210278
2-[(Z)-2-(4-methoxy-3,5-dinitrophenyl)ethenyl]naphthalene (PubChem CID 11210278) has the molecular formula C19H14N2O5 and a molecular weight of 350.33 g/mol. Its IUPAC name is 2-[(Z)-2-(4-methoxy-3,5-dinitrophenyl)ethenyl]naphthalene.
| Compound Name | 2-[(Z)-2-(4-methoxy-3,5-dinitrophenyl)ethenyl]naphthalene |
|---|---|
| PubChem CID | 11210278 |
| Molecular Formula | C19H14N2O5 |
| Molecular Weight | 350.33 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | 2-[(Z)-2-(4-methoxy-3,5-dinitrophenyl)ethenyl]naphthalene |
| SMILES | COc1c([N+](=O)[O-])cc(/C=C\c2ccc3ccccc3c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H14N2O5/c1-26-19-17(20(22)23)11-14(12-18(19)21(24)25)7-6-13-8-9-15-4-2-3-5-16(15)10-13/h2-12H,1H3/b7-6- |
| InChIKey | BLHQCCBDGWGFJW-SREVYHEPSA-N |
| XLogP | 4.84 |
| TPSA | 95.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.33 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|