C20H17NO4 — CID 11151810
2-[(Z)-2-(3,4-dimethoxy-5-nitrophenyl)ethenyl]naphthalene (PubChem CID 11151810) has the molecular formula C20H17NO4 and a molecular weight of 335.36 g/mol. Its IUPAC name is 2-[(Z)-2-(3,4-dimethoxy-5-nitrophenyl)ethenyl]naphthalene.
| Compound Name | 2-[(Z)-2-(3,4-dimethoxy-5-nitrophenyl)ethenyl]naphthalene |
|---|---|
| PubChem CID | 11151810 |
| Molecular Formula | C20H17NO4 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | 2-[(Z)-2-(3,4-dimethoxy-5-nitrophenyl)ethenyl]naphthalene |
| SMILES | COc1cc(/C=C\c2ccc3ccccc3c2)cc([N+](=O)[O-])c1OC |
| InChI | InChI=1S/C20H17NO4/c1-24-19-13-15(12-18(21(22)23)20(19)25-2)8-7-14-9-10-16-5-3-4-6-17(16)11-14/h3-13H,1-2H3/b8-7- |
| InChIKey | HMBHLSFDCBXYET-FPLPWBNLSA-N |
| XLogP | 4.94 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|