C24H30ClNO6 — CID 45261098
[4-(3-amino-4,5-dimethoxyphenyl)-6,7-diethoxy-3-(hydroxymethyl)naphthalen-2-yl]methanol;hydrochloride (PubChem CID 45261098) has the molecular formula C24H30ClNO6 and a molecular weight of 463.96 g/mol. Its IUPAC name is [4-(3-amino-4,5-dimethoxyphenyl)-6,7-diethoxy-3-(hydroxymethyl)naphthalen-2-yl]methanol;hydrochloride.
| Compound Name | [4-(3-amino-4,5-dimethoxyphenyl)-6,7-diethoxy-3-(hydroxymethyl)naphthalen-2-yl]methanol;hydrochloride |
|---|---|
| PubChem CID | 45261098 |
| Molecular Formula | C24H30ClNO6 |
| Molecular Weight | 463.96 g/mol |
| Exact Mass | 463.18 |
| IUPAC Name | [4-(3-amino-4,5-dimethoxyphenyl)-6,7-diethoxy-3-(hydroxymethyl)naphthalen-2-yl]methanol;hydrochloride |
| SMILES | CCOc1cc2cc(CO)c(CO)c(-c3cc(N)c(OC)c(OC)c3)c2cc1OCC.Cl |
| InChI | InChI=1S/C24H29NO6.ClH/c1-5-30-20-9-14-7-16(12-26)18(13-27)23(17(14)11-21(20)31-6-2)15-8-19(25)24(29-4)22(10-15)28-3;/h7-11,26-27H,5-6,12-13,25H2,1-4H3;1H |
| InChIKey | FFPIBIWSDYHXRG-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.96 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|