C24H27N3O6 — CID 134943538
2,3,6,7,10,11-hexamethoxytriphenylene-1,5,9-triamine (PubChem CID 134943538) has the molecular formula C24H27N3O6 and a molecular weight of 453.50 g/mol. Its IUPAC name is 2,3,6,7,10,11-hexamethoxytriphenylene-1,5,9-triamine.
| Compound Name | 2,3,6,7,10,11-hexamethoxytriphenylene-1,5,9-triamine |
|---|---|
| PubChem CID | 134943538 |
| Molecular Formula | C24H27N3O6 |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | 2,3,6,7,10,11-hexamethoxytriphenylene-1,5,9-triamine |
| SMILES | COc1cc2c(c(N)c1OC)c1cc(OC)c(OC)c(N)c1c1cc(OC)c(OC)c(N)c21 |
| InChI | InChI=1S/C24H27N3O6/c1-28-13-7-10-16(19(25)22(13)31-4)11-8-14(29-2)24(33-6)21(27)18(11)12-9-15(30-3)23(32-5)20(26)17(10)12/h7-9H,25-27H2,1-6H3 |
| InChIKey | BIOYFVFSOFPSGD-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 133.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|