C20H19NO2 — CID 11174230
2,3-dimethoxy-5-[(Z)-2-naphthalen-2-ylethenyl]aniline (PubChem CID 11174230) has the molecular formula C20H19NO2 and a molecular weight of 305.38 g/mol. Its IUPAC name is 2,3-dimethoxy-5-[(Z)-2-naphthalen-2-ylethenyl]aniline.
| Compound Name | 2,3-dimethoxy-5-[(Z)-2-naphthalen-2-ylethenyl]aniline |
|---|---|
| PubChem CID | 11174230 |
| Molecular Formula | C20H19NO2 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 2,3-dimethoxy-5-[(Z)-2-naphthalen-2-ylethenyl]aniline |
| SMILES | COc1cc(/C=C\c2ccc3ccccc3c2)cc(N)c1OC |
| InChI | InChI=1S/C20H19NO2/c1-22-19-13-15(12-18(21)20(19)23-2)8-7-14-9-10-16-5-3-4-6-17(16)11-14/h3-13H,21H2,1-2H3/b8-7- |
| InChIKey | ACLBXENVWSKUGV-FPLPWBNLSA-N |
| XLogP | 4.61 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|