C26H25NO4 — CID 22716425
2-(6,7-dimethoxynaphthalen-2-yl)-5-methoxy-4-phenylmethoxyaniline (PubChem CID 22716425) has the molecular formula C26H25NO4 and a molecular weight of 415.49 g/mol. Its IUPAC name is 2-(6,7-dimethoxynaphthalen-2-yl)-5-methoxy-4-phenylmethoxyaniline.
| Compound Name | 2-(6,7-dimethoxynaphthalen-2-yl)-5-methoxy-4-phenylmethoxyaniline |
|---|---|
| PubChem CID | 22716425 |
| Molecular Formula | C26H25NO4 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | 2-(6,7-dimethoxynaphthalen-2-yl)-5-methoxy-4-phenylmethoxyaniline |
| SMILES | COc1cc2ccc(-c3cc(OCc4ccccc4)c(OC)cc3N)cc2cc1OC |
| InChI | InChI=1S/C26H25NO4/c1-28-23-12-18-9-10-19(11-20(18)13-24(23)29-2)21-14-26(25(30-3)15-22(21)27)31-16-17-7-5-4-6-8-17/h4-15H,16,27H2,1-3H3 |
| InChIKey | IVJKEYMZPAVKFY-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 62.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|