C22H32N2O4 — CID 10916091
2-[(2S,3R)-4-(2-amino-4,5-dimethoxyphenyl)-2,3-dimethylbutyl]-4,5-dimethoxyaniline (PubChem CID 10916091) has the molecular formula C22H32N2O4 and a molecular weight of 388.51 g/mol. Its IUPAC name is 2-[(2S,3R)-4-(2-amino-4,5-dimethoxyphenyl)-2,3-dimethylbutyl]-4,5-dimethoxyaniline.
| Compound Name | 2-[(2S,3R)-4-(2-amino-4,5-dimethoxyphenyl)-2,3-dimethylbutyl]-4,5-dimethoxyaniline |
|---|---|
| PubChem CID | 10916091 |
| Molecular Formula | C22H32N2O4 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | 2-[(2S,3R)-4-(2-amino-4,5-dimethoxyphenyl)-2,3-dimethylbutyl]-4,5-dimethoxyaniline |
| SMILES | COc1cc(N)c(C[C@@H](C)[C@@H](C)Cc2cc(OC)c(OC)cc2N)cc1OC |
| InChI | InChI=1S/C22H32N2O4/c1-13(7-15-9-19(25-3)21(27-5)11-17(15)23)14(2)8-16-10-20(26-4)22(28-6)12-18(16)24/h9-14H,7-8,23-24H2,1-6H3/t13-,14+ |
| InChIKey | SQYDBDYFBPIJDY-OKILXGFUSA-N |
| XLogP | 3.94 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|