C22H32O3Si — CID 11210996
(4R)-4-[(E,1R)-1-[tert-butyl(dimethyl)silyl]oxy-4-phenylmethoxybut-2-enyl]cyclopent-2-en-1-one (PubChem CID 11210996) has the molecular formula C22H32O3Si and a molecular weight of 372.58 g/mol. Its IUPAC name is (4R)-4-[(E,1R)-1-[tert-butyl(dimethyl)silyl]oxy-4-phenylmethoxybut-2-enyl]cyclopent-2-en-1-one.
| Compound Name | (4R)-4-[(E,1R)-1-[tert-butyl(dimethyl)silyl]oxy-4-phenylmethoxybut-2-enyl]cyclopent-2-en-1-one |
|---|---|
| PubChem CID | 11210996 |
| Molecular Formula | C22H32O3Si |
| Molecular Weight | 372.58 g/mol |
| Exact Mass | 372.21 |
| IUPAC Name | (4R)-4-[(E,1R)-1-[tert-butyl(dimethyl)silyl]oxy-4-phenylmethoxybut-2-enyl]cyclopent-2-en-1-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H](/C=C/COCc1ccccc1)[C@H]1C=CC(=O)C1 |
| InChI | InChI=1S/C22H32O3Si/c1-22(2,3)26(4,5)25-21(19-13-14-20(23)16-19)12-9-15-24-17-18-10-7-6-8-11-18/h6-14,19,21H,15-17H2,1-5H3/b12-9+/t19-,21+/m0/s1 |
| InChIKey | IXYZZKKHXUFXIO-PSUSJVNBSA-N |
| XLogP | 5.30 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.58 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|