C25H19NO3 — CID 11211221
3-benzyl-6-oxo-5-phenyl-2-[(E)-2-phenylethenyl]-1,3-oxazin-3-ium-4-olate (PubChem CID 11211221) has the molecular formula C25H19NO3 and a molecular weight of 381.43 g/mol. Its IUPAC name is 3-benzyl-6-oxo-5-phenyl-2-[(E)-2-phenylethenyl]-1,3-oxazin-3-ium-4-olate.
| Compound Name | 3-benzyl-6-oxo-5-phenyl-2-[(E)-2-phenylethenyl]-1,3-oxazin-3-ium-4-olate |
|---|---|
| PubChem CID | 11211221 |
| Molecular Formula | C25H19NO3 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | 3-benzyl-6-oxo-5-phenyl-2-[(E)-2-phenylethenyl]-1,3-oxazin-3-ium-4-olate |
| SMILES | O=c1oc(/C=C/c2ccccc2)[n+](Cc2ccccc2)c([O-])c1-c1ccccc1 |
| InChI | InChI=1S/C25H19NO3/c27-24-23(21-14-8-3-9-15-21)25(28)29-22(17-16-19-10-4-1-5-11-19)26(24)18-20-12-6-2-7-13-20/h1-17H,18H2/b17-16+ |
| InChIKey | XCHKMHPCFBHXAE-WUKNDPDISA-N |
| XLogP | 3.89 |
| TPSA | 57.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|