C24H17NO3 — CID 11485432
6-oxo-3,5-diphenyl-2-[(E)-2-phenylethenyl]-1,3-oxazin-3-ium-4-olate (PubChem CID 11485432) has the molecular formula C24H17NO3 and a molecular weight of 367.40 g/mol. Its IUPAC name is 6-oxo-3,5-diphenyl-2-[(E)-2-phenylethenyl]-1,3-oxazin-3-ium-4-olate.
| Compound Name | 6-oxo-3,5-diphenyl-2-[(E)-2-phenylethenyl]-1,3-oxazin-3-ium-4-olate |
|---|---|
| PubChem CID | 11485432 |
| Molecular Formula | C24H17NO3 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | 6-oxo-3,5-diphenyl-2-[(E)-2-phenylethenyl]-1,3-oxazin-3-ium-4-olate |
| SMILES | O=c1oc(/C=C/c2ccccc2)[n+](-c2ccccc2)c([O-])c1-c1ccccc1 |
| InChI | InChI=1S/C24H17NO3/c26-23-22(19-12-6-2-7-13-19)24(27)28-21(17-16-18-10-4-1-5-11-18)25(23)20-14-8-3-9-15-20/h1-17H/b17-16+ |
| InChIKey | ATAXFHNHFZKWJA-WUKNDPDISA-N |
| XLogP | 3.83 |
| TPSA | 57.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|