C27H22N2O4 — CID 146675025
dimethyl 1,4-diphenyl-6-phenyliminopyridine-2,3-dicarboxylate (PubChem CID 146675025) has the molecular formula C27H22N2O4 and a molecular weight of 438.48 g/mol. Its IUPAC name is dimethyl 1,4-diphenyl-6-phenyliminopyridine-2,3-dicarboxylate.
| Compound Name | dimethyl 1,4-diphenyl-6-phenyliminopyridine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 146675025 |
| Molecular Formula | C27H22N2O4 |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | dimethyl 1,4-diphenyl-6-phenyliminopyridine-2,3-dicarboxylate |
| SMILES | COC(=O)c1c(-c2ccccc2)c/c(=N\c2ccccc2)n(-c2ccccc2)c1C(=O)OC |
| InChI | InChI=1S/C27H22N2O4/c1-32-26(30)24-22(19-12-6-3-7-13-19)18-23(28-20-14-8-4-9-15-20)29(25(24)27(31)33-2)21-16-10-5-11-17-21/h3-18H,1-2H3/b28-23+ |
| InChIKey | XJPOSZVQKGIOSG-WEMUOSSPSA-N |
| XLogP | 4.95 |
| TPSA | 69.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |