C34H29NO4 — CID 102529388
dimethyl 1-(4-methylphenyl)-4,6,6-triphenylpyridine-2,3-dicarboxylate (PubChem CID 102529388) has the molecular formula C34H29NO4 and a molecular weight of 515.61 g/mol. Its IUPAC name is dimethyl 1-(4-methylphenyl)-4,6,6-triphenylpyridine-2,3-dicarboxylate.
| Compound Name | dimethyl 1-(4-methylphenyl)-4,6,6-triphenylpyridine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 102529388 |
| Molecular Formula | C34H29NO4 |
| Molecular Weight | 515.61 g/mol |
| Exact Mass | 515.21 |
| IUPAC Name | dimethyl 1-(4-methylphenyl)-4,6,6-triphenylpyridine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2ccc(C)cc2)C(c2ccccc2)(c2ccccc2)C=C1c1ccccc1 |
| InChI | InChI=1S/C34H29NO4/c1-24-19-21-28(22-20-24)35-31(33(37)39-3)30(32(36)38-2)29(25-13-7-4-8-14-25)23-34(35,26-15-9-5-10-16-26)27-17-11-6-12-18-27/h4-23H,1-3H3 |
| InChIKey | UCLMDFJAVPRTHP-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.61 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |