C26H21N3O4 — CID 102414175
dimethyl 2,3-diphenyl-6-phenyliminopyrimidine-4,5-dicarboxylate (PubChem CID 102414175) has the molecular formula C26H21N3O4 and a molecular weight of 439.47 g/mol. Its IUPAC name is dimethyl 2,3-diphenyl-6-phenyliminopyrimidine-4,5-dicarboxylate.
| Compound Name | dimethyl 2,3-diphenyl-6-phenyliminopyrimidine-4,5-dicarboxylate |
|---|---|
| PubChem CID | 102414175 |
| Molecular Formula | C26H21N3O4 |
| Molecular Weight | 439.47 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | dimethyl 2,3-diphenyl-6-phenyliminopyrimidine-4,5-dicarboxylate |
| SMILES | COC(=O)c1c(C(=O)OC)n(-c2ccccc2)c(-c2ccccc2)n/c1=N\c1ccccc1 |
| InChI | InChI=1S/C26H21N3O4/c1-32-25(30)21-22(26(31)33-2)29(20-16-10-5-11-17-20)24(18-12-6-3-7-13-18)28-23(21)27-19-14-8-4-9-15-19/h3-17H,1-2H3/b27-23- |
| InChIKey | NJSBDGQWMDYSIP-VYIQYICTSA-N |
| XLogP | 4.34 |
| TPSA | 82.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.47 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |