C26H24N2O4 — CID 139045369
dimethyl (2S)-1,2,3-triphenyl-2,4-dihydropyrimidine-5,6-dicarboxylate (PubChem CID 139045369) has the molecular formula C26H24N2O4 and a molecular weight of 428.49 g/mol. Its IUPAC name is dimethyl (2S)-1,2,3-triphenyl-2,4-dihydropyrimidine-5,6-dicarboxylate.
| Compound Name | dimethyl (2S)-1,2,3-triphenyl-2,4-dihydropyrimidine-5,6-dicarboxylate |
|---|---|
| PubChem CID | 139045369 |
| Molecular Formula | C26H24N2O4 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | dimethyl (2S)-1,2,3-triphenyl-2,4-dihydropyrimidine-5,6-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2ccccc2)[C@@H](c2ccccc2)N(c2ccccc2)C1 |
| InChI | InChI=1S/C26H24N2O4/c1-31-25(29)22-18-27(20-14-8-4-9-15-20)24(19-12-6-3-7-13-19)28(23(22)26(30)32-2)21-16-10-5-11-17-21/h3-17,24H,18H2,1-2H3/t24-/m0/s1 |
| InChIKey | OCJHJJRDJXPUEP-DEOSSOPVSA-N |
| XLogP | 4.31 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |