C25H26N2O4 — CID 146675021
dimethyl 6-butylimino-1,4-diphenylpyridine-2,3-dicarboxylate (PubChem CID 146675021) has the molecular formula C25H26N2O4 and a molecular weight of 418.49 g/mol. Its IUPAC name is dimethyl 6-butylimino-1,4-diphenylpyridine-2,3-dicarboxylate.
| Compound Name | dimethyl 6-butylimino-1,4-diphenylpyridine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 146675021 |
| Molecular Formula | C25H26N2O4 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | dimethyl 6-butylimino-1,4-diphenylpyridine-2,3-dicarboxylate |
| SMILES | CCCC/N=c1\cc(-c2ccccc2)c(C(=O)OC)c(C(=O)OC)n1-c1ccccc1 |
| InChI | InChI=1S/C25H26N2O4/c1-4-5-16-26-21-17-20(18-12-8-6-9-13-18)22(24(28)30-2)23(25(29)31-3)27(21)19-14-10-7-11-15-19/h6-15,17H,4-5,16H2,1-3H3/b26-21+ |
| InChIKey | VNKQUQOUMOVNQF-YYADALCUSA-N |
| XLogP | 4.42 |
| TPSA | 69.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|