C27H23N3O4 — CID 102414173
dimethyl 6-(4-methylphenyl)imino-2,3-diphenylpyrimidine-4,5-dicarboxylate (PubChem CID 102414173) has the molecular formula C27H23N3O4 and a molecular weight of 453.50 g/mol. Its IUPAC name is dimethyl 6-(4-methylphenyl)imino-2,3-diphenylpyrimidine-4,5-dicarboxylate.
| Compound Name | dimethyl 6-(4-methylphenyl)imino-2,3-diphenylpyrimidine-4,5-dicarboxylate |
|---|---|
| PubChem CID | 102414173 |
| Molecular Formula | C27H23N3O4 |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.17 |
| IUPAC Name | dimethyl 6-(4-methylphenyl)imino-2,3-diphenylpyrimidine-4,5-dicarboxylate |
| SMILES | COC(=O)c1c(C(=O)OC)n(-c2ccccc2)c(-c2ccccc2)n/c1=N\c1ccc(C)cc1 |
| InChI | InChI=1S/C27H23N3O4/c1-18-14-16-20(17-15-18)28-24-22(26(31)33-2)23(27(32)34-3)30(21-12-8-5-9-13-21)25(29-24)19-10-6-4-7-11-19/h4-17H,1-3H3/b28-24- |
| InChIKey | AGQRFEZPYOBXAN-COOPMVRXSA-N |
| XLogP | 4.65 |
| TPSA | 82.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |