C30H22N2O2 — CID 11464898
2-[(Z)-2-amino-1,2-diphenylethenyl]-4,5-diphenyl-1,3-oxazin-6-one (PubChem CID 11464898) has the molecular formula C30H22N2O2 and a molecular weight of 442.52 g/mol. Its IUPAC name is 2-[(Z)-2-amino-1,2-diphenylethenyl]-4,5-diphenyl-1,3-oxazin-6-one.
| Compound Name | 2-[(Z)-2-amino-1,2-diphenylethenyl]-4,5-diphenyl-1,3-oxazin-6-one |
|---|---|
| PubChem CID | 11464898 |
| Molecular Formula | C30H22N2O2 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | 2-[(Z)-2-amino-1,2-diphenylethenyl]-4,5-diphenyl-1,3-oxazin-6-one |
| SMILES | N/C(=C(/c1ccccc1)c1nc(-c2ccccc2)c(-c2ccccc2)c(=O)o1)c1ccccc1 |
| InChI | InChI=1S/C30H22N2O2/c31-27(23-17-9-3-10-18-23)25(21-13-5-1-6-14-21)29-32-28(24-19-11-4-12-20-24)26(30(33)34-29)22-15-7-2-8-16-22/h1-20H,31H2/b27-25- |
| InChIKey | DJRPKXCGLMWECL-RFBIWTDZSA-N |
| XLogP | 6.24 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|