C23H30O4S — CID 11211810
[(1S,2R,4R)-1-(benzenesulfonylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] 5-methylhexa-2,3-dienoate (PubChem CID 11211810) has the molecular formula C23H30O4S and a molecular weight of 402.56 g/mol. Its IUPAC name is [(1S,2R,4R)-1-(benzenesulfonylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] 5-methylhexa-2,3-dienoate.
| Compound Name | [(1S,2R,4R)-1-(benzenesulfonylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] 5-methylhexa-2,3-dienoate |
|---|---|
| PubChem CID | 11211810 |
| Molecular Formula | C23H30O4S |
| Molecular Weight | 402.56 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | [(1S,2R,4R)-1-(benzenesulfonylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] 5-methylhexa-2,3-dienoate |
| SMILES | CC(C)C=C=CC(=O)O[C@@H]1C[C@H]2CC[C@]1(CS(=O)(=O)c1ccccc1)C2(C)C |
| InChI | InChI=1S/C23H30O4S/c1-17(2)9-8-12-21(24)27-20-15-18-13-14-23(20,22(18,3)4)16-28(25,26)19-10-6-5-7-11-19/h5-7,9-12,17-18,20H,13-16H2,1-4H3/t8?,18-,20-,23-/m1/s1 |
| InChIKey | DXMBLMXFAFPRFE-ZAOXYJOXSA-N |
| XLogP | 4.57 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.56 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|