C19H36O6S2 — CID 11212433
(3R)-4-[(2S,6S,8R,10S)-4,4-bis(ethylsulfanyl)-10-hydroxy-8-(2-hydroxyethyl)-1,7-dioxaspiro[5.5]undecan-2-yl]butane-1,3-diol (PubChem CID 11212433) has the molecular formula C19H36O6S2 and a molecular weight of 424.63 g/mol. Its IUPAC name is (3R)-4-[(2S,6S,8R,10S)-4,4-bis(ethylsulfanyl)-10-hydroxy-8-(2-hydroxyethyl)-1,7-dioxaspiro[5.5]undecan-2-yl]butane-1,3-diol.
| Compound Name | (3R)-4-[(2S,6S,8R,10S)-4,4-bis(ethylsulfanyl)-10-hydroxy-8-(2-hydroxyethyl)-1,7-dioxaspiro[5.5]undecan-2-yl]butane-1,3-diol |
|---|---|
| PubChem CID | 11212433 |
| Molecular Formula | C19H36O6S2 |
| Molecular Weight | 424.63 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | (3R)-4-[(2S,6S,8R,10S)-4,4-bis(ethylsulfanyl)-10-hydroxy-8-(2-hydroxyethyl)-1,7-dioxaspiro[5.5]undecan-2-yl]butane-1,3-diol |
| SMILES | CCSC1(SCC)C[C@H](C[C@H](O)CCO)O[C@@]2(C[C@@H](O)C[C@@H](CCO)O2)C1 |
| InChI | InChI=1S/C19H36O6S2/c1-3-26-19(27-4-2)12-17(9-14(22)5-7-20)25-18(13-19)11-15(23)10-16(24-18)6-8-21/h14-17,20-23H,3-13H2,1-2H3/t14-,15+,16-,17+,18+/m1/s1 |
| InChIKey | TVKCGJHHKIIZCM-WKULXVSPSA-N |
| XLogP | 2.12 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.63 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|