C16H32O3S2 — CID 593791
1-[2-[3-(1-ethoxyethoxy)propyl]-1,3-dithian-2-yl]pentan-3-ol (PubChem CID 593791) has the molecular formula C16H32O3S2 and a molecular weight of 336.56 g/mol. Its IUPAC name is 1-[2-[3-(1-ethoxyethoxy)propyl]-1,3-dithian-2-yl]pentan-3-ol.
| Compound Name | 1-[2-[3-(1-ethoxyethoxy)propyl]-1,3-dithian-2-yl]pentan-3-ol |
|---|---|
| PubChem CID | 593791 |
| Molecular Formula | C16H32O3S2 |
| Molecular Weight | 336.56 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | 1-[2-[3-(1-ethoxyethoxy)propyl]-1,3-dithian-2-yl]pentan-3-ol |
| SMILES | CCOC(C)OCCCC1(CCC(O)CC)SCCCS1 |
| InChI | InChI=1S/C16H32O3S2/c1-4-15(17)8-10-16(20-12-7-13-21-16)9-6-11-19-14(3)18-5-2/h14-15,17H,4-13H2,1-3H3 |
| InChIKey | JBIMONITOVULFC-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.56 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|