C15H30O3S2 — CID 588566
4-[2-[3-(1-ethoxyethoxy)propyl]-1,3-dithian-2-yl]butan-2-ol (PubChem CID 588566) has the molecular formula C15H30O3S2 and a molecular weight of 322.54 g/mol. Its IUPAC name is 4-[2-[3-(1-ethoxyethoxy)propyl]-1,3-dithian-2-yl]butan-2-ol.
| Compound Name | 4-[2-[3-(1-ethoxyethoxy)propyl]-1,3-dithian-2-yl]butan-2-ol |
|---|---|
| PubChem CID | 588566 |
| Molecular Formula | C15H30O3S2 |
| Molecular Weight | 322.54 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | 4-[2-[3-(1-ethoxyethoxy)propyl]-1,3-dithian-2-yl]butan-2-ol |
| SMILES | CCOC(C)OCCCC1(CCC(C)O)SCCCS1 |
| InChI | InChI=1S/C15H30O3S2/c1-4-17-14(3)18-10-5-8-15(9-7-13(2)16)19-11-6-12-20-15/h13-14,16H,4-12H2,1-3H3 |
| InChIKey | UXTZDZLWPYDVDQ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.54 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|