C10H18O2S2 — CID 10823613
8-ethyl-9-oxa-1,5-dithiaspiro[5.5]undecan-10-ol (PubChem CID 10823613) has the molecular formula C10H18O2S2 and a molecular weight of 234.39 g/mol. Its IUPAC name is 8-ethyl-9-oxa-1,5-dithiaspiro[5.5]undecan-10-ol.
| Compound Name | 8-ethyl-9-oxa-1,5-dithiaspiro[5.5]undecan-10-ol |
|---|---|
| PubChem CID | 10823613 |
| Molecular Formula | C10H18O2S2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | 8-ethyl-9-oxa-1,5-dithiaspiro[5.5]undecan-10-ol |
| SMILES | CCC1CC2(CC(O)O1)SCCCS2 |
| InChI | InChI=1S/C10H18O2S2/c1-2-8-6-10(7-9(11)12-8)13-4-3-5-14-10/h8-9,11H,2-7H2,1H3 |
| InChIKey | YKJVYIXWDGDURW-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |