C12H22O4S2 — CID 101197358
[(8S,10R)-10-(dimethoxymethyl)-9-oxa-1,5-dithiaspiro[5.5]undecan-8-yl]methanol (PubChem CID 101197358) has the molecular formula C12H22O4S2 and a molecular weight of 294.44 g/mol. Its IUPAC name is [(8S,10R)-10-(dimethoxymethyl)-9-oxa-1,5-dithiaspiro[5.5]undecan-8-yl]methanol.
| Compound Name | [(8S,10R)-10-(dimethoxymethyl)-9-oxa-1,5-dithiaspiro[5.5]undecan-8-yl]methanol |
|---|---|
| PubChem CID | 101197358 |
| Molecular Formula | C12H22O4S2 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | [(8S,10R)-10-(dimethoxymethyl)-9-oxa-1,5-dithiaspiro[5.5]undecan-8-yl]methanol |
| SMILES | COC(OC)[C@H]1CC2(C[C@@H](CO)O1)SCCCS2 |
| InChI | InChI=1S/C12H22O4S2/c1-14-11(15-2)10-7-12(6-9(8-13)16-10)17-4-3-5-18-12/h9-11,13H,3-8H2,1-2H3/t9-,10+/m0/s1 |
| InChIKey | ZJKDNJKGKAOVGU-VHSXEESVSA-N |
| XLogP | 1.71 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|