C15H28O3S2 — CID 71714030
(3R)-3-[2-[2-(oxan-2-yloxy)ethyl]-1,3-dithian-2-yl]butan-2-ol (PubChem CID 71714030) has the molecular formula C15H28O3S2 and a molecular weight of 320.52 g/mol. Its IUPAC name is (3R)-3-[2-[2-(oxan-2-yloxy)ethyl]-1,3-dithian-2-yl]butan-2-ol.
| Compound Name | (3R)-3-[2-[2-(oxan-2-yloxy)ethyl]-1,3-dithian-2-yl]butan-2-ol |
|---|---|
| PubChem CID | 71714030 |
| Molecular Formula | C15H28O3S2 |
| Molecular Weight | 320.52 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | (3R)-3-[2-[2-(oxan-2-yloxy)ethyl]-1,3-dithian-2-yl]butan-2-ol |
| SMILES | CC(O)[C@@H](C)C1(CCOC2CCCCO2)SCCCS1 |
| InChI | InChI=1S/C15H28O3S2/c1-12(13(2)16)15(19-10-5-11-20-15)7-9-18-14-6-3-4-8-17-14/h12-14,16H,3-11H2,1-2H3/t12-,13?,14?/m1/s1 |
| InChIKey | PKMMXKPKHDKLFW-IYXRBSQSSA-N |
| XLogP | 3.50 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.52 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |