C16H32O5S2 — CID 134936620
3-[2-(2,2-dimethoxyethyl)-1,3-dithian-2-yl]-1,1-diethoxybutan-2-ol (PubChem CID 134936620) has the molecular formula C16H32O5S2 and a molecular weight of 368.56 g/mol. Its IUPAC name is 3-[2-(2,2-dimethoxyethyl)-1,3-dithian-2-yl]-1,1-diethoxybutan-2-ol.
| Compound Name | 3-[2-(2,2-dimethoxyethyl)-1,3-dithian-2-yl]-1,1-diethoxybutan-2-ol |
|---|---|
| PubChem CID | 134936620 |
| Molecular Formula | C16H32O5S2 |
| Molecular Weight | 368.56 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | 3-[2-(2,2-dimethoxyethyl)-1,3-dithian-2-yl]-1,1-diethoxybutan-2-ol |
| SMILES | CCOC(OCC)C(O)C(C)C1(CC(OC)OC)SCCCS1 |
| InChI | InChI=1S/C16H32O5S2/c1-6-20-15(21-7-2)14(17)12(3)16(11-13(18-4)19-5)22-9-8-10-23-16/h12-15,17H,6-11H2,1-5H3 |
| InChIKey | CXCMGKQGOVYVAX-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.56 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|