C22H42O3S2 — CID 15685600
1-[2-[10-(oxan-2-yloxy)decyl]-1,3-dithian-2-yl]propan-2-ol (PubChem CID 15685600) has the molecular formula C22H42O3S2 and a molecular weight of 418.71 g/mol. Its IUPAC name is 1-[2-[10-(oxan-2-yloxy)decyl]-1,3-dithian-2-yl]propan-2-ol.
| Compound Name | 1-[2-[10-(oxan-2-yloxy)decyl]-1,3-dithian-2-yl]propan-2-ol |
|---|---|
| PubChem CID | 15685600 |
| Molecular Formula | C22H42O3S2 |
| Molecular Weight | 418.71 g/mol |
| Exact Mass | 418.26 |
| IUPAC Name | 1-[2-[10-(oxan-2-yloxy)decyl]-1,3-dithian-2-yl]propan-2-ol |
| SMILES | CC(O)CC1(CCCCCCCCCCOC2CCCCO2)SCCCS1 |
| InChI | InChI=1S/C22H42O3S2/c1-20(23)19-22(26-17-12-18-27-22)14-9-6-4-2-3-5-7-10-15-24-21-13-8-11-16-25-21/h20-21,23H,2-19H2,1H3 |
| InChIKey | IMNHIEXBKCXLCS-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.71 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|