About 2-(1,3-dithian-2-yl)oxan-2-ol
2-(1,3-dithian-2-yl)oxan-2-ol (PubChem CID 14295444) has the molecular formula C9H16O2S2
and a molecular weight of 220.36 g/mol. Its IUPAC name is 2-(1,3-dithian-2-yl)oxan-2-ol.
Molecular Properties
| Compound Name | 2-(1,3-dithian-2-yl)oxan-2-ol |
| PubChem CID | 14295444 |
| Molecular Formula | C9H16O2S2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.06 |
| IUPAC Name | 2-(1,3-dithian-2-yl)oxan-2-ol |
| SMILES | OC1(C2SCCCS2)CCCCO1 |
| InChI | InChI=1S/C9H16O2S2/c10-9(4-1-2-5-11-9)8-12-6-3-7-13-8/h8,10H,1-7H2 |
| InChIKey | HRFDKPJWRYROST-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(1,3-dithian-2-yl)oxan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-dithian-2-yl)oxan-2-ol?
The IUPAC name of 2-(1,3-dithian-2-yl)oxan-2-ol (CID 14295444) is 2-(1,3-dithian-2-yl)oxan-2-ol.
What is the SMILES notation for 2-(1,3-dithian-2-yl)oxan-2-ol?
The canonical SMILES for 2-(1,3-dithian-2-yl)oxan-2-ol is OC1(C2SCCCS2)CCCCO1.
What is the InChIKey of 2-(1,3-dithian-2-yl)oxan-2-ol?
The InChIKey is HRFDKPJWRYROST-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O2S2/c10-9(4-1-2-5-11-9)8-12-6-3-7-13-8/h8,10H,1-7H2.
What are the key properties of 2-(1,3-dithian-2-yl)oxan-2-ol?
2-(1,3-dithian-2-yl)oxan-2-ol has a molecular weight of 220.36 g/mol, XLogP of 2.07, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-dithian-2-yl)oxan-2-ol is sourced from PubChem (CID 14295444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).