C15H28O3S2 — CID 134937331
(2S)-2-[2-[2-[3-(1-ethoxyethoxy)propyl]-1,3-dithian-2-yl]ethyl]oxirane (PubChem CID 134937331) has the molecular formula C15H28O3S2 and a molecular weight of 320.52 g/mol. Its IUPAC name is (2S)-2-[2-[2-[3-(1-ethoxyethoxy)propyl]-1,3-dithian-2-yl]ethyl]oxirane.
| Compound Name | (2S)-2-[2-[2-[3-(1-ethoxyethoxy)propyl]-1,3-dithian-2-yl]ethyl]oxirane |
|---|---|
| PubChem CID | 134937331 |
| Molecular Formula | C15H28O3S2 |
| Molecular Weight | 320.52 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | (2S)-2-[2-[2-[3-(1-ethoxyethoxy)propyl]-1,3-dithian-2-yl]ethyl]oxirane |
| SMILES | CCOC(C)OCCCC1(CC[C@H]2CO2)SCCCS1 |
| InChI | InChI=1S/C15H28O3S2/c1-3-16-13(2)17-9-4-7-15(8-6-14-12-18-14)19-10-5-11-20-15/h13-14H,3-12H2,1-2H3/t13?,14-/m0/s1 |
| InChIKey | ZMTSIJZDNGXJHT-KZUDCZAMSA-N |
| XLogP | 3.91 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.52 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|