C14H28O2S2 — CID 24977480
2-butyl-2-(2,2-diethoxyethyl)-1,3-dithiane (PubChem CID 24977480) has the molecular formula C14H28O2S2 and a molecular weight of 292.51 g/mol. Its IUPAC name is 2-butyl-2-(2,2-diethoxyethyl)-1,3-dithiane.
| Compound Name | 2-butyl-2-(2,2-diethoxyethyl)-1,3-dithiane |
|---|---|
| PubChem CID | 24977480 |
| Molecular Formula | C14H28O2S2 |
| Molecular Weight | 292.51 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 2-butyl-2-(2,2-diethoxyethyl)-1,3-dithiane |
| SMILES | CCCCC1(CC(OCC)OCC)SCCCS1 |
| InChI | InChI=1S/C14H28O2S2/c1-4-7-9-14(17-10-8-11-18-14)12-13(15-5-2)16-6-3/h13H,4-12H2,1-3H3 |
| InChIKey | PVVCCAIXJFQOCZ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.51 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|